How many grams are in 1 mole of C6H8O6?
Explanation: The molar mass of ascorbic acid is 176 grams/mole’ . This means that every 1 mole of ascorbic acid will have a mass of 176 grams.
What is the correct molecular weight of Vitamin C C6H8O6 )?
176.124 g/mol
The molecular formula C6H8O6 (molar mass: 176.124 g/mol) may be: Ascorbic acid (vitamin C) Erythorbic acid.
What is the mass in grams of 0.000142 mol of Vitamin C C6H8O6?
question. Answer ⇒ The mass of the 0.000142 mole of Vitamin C is 0.024 g.
What is the molar mass of c6h6o6?
174.11
Benzenehexol
| PubChem CID | 69102 |
|---|---|
| Molecular Formula | C6H6O6 |
| Synonyms | Benzenehexol Hexahydroxybenzene 608-80-0 1,2,3,4,5,6-benzenehexol benzene-1,2,3,4,5,6-hexol More… |
| Molecular Weight | 174.11 |
| Dates | Modify 2022-04-16 Create 2005-03-26 |
What is the formula weight of hypochlorous acid?
52.46 g/molHypochlorous acid / Molar mass
What is L in L ascorbic acid?
Pure Vitamin C is known as L-Ascorbic Acid. The “L” in front of Ascorbic is a reference to how the molecule itself rotates to light and refers to its source. L-Ascorbic Acid comes from natural sources such as oranges.
What are the elements of C6H8O6?
Identification of L-ascorbic acid Chemical Compound
| Chemical Formula | C6H8O6 |
|---|---|
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2,5-dihydrofuran-2-one |
| SMILES String | OCC(O)C1OC(=O)C(=C1O)O |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| InChIKey | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
What is the formula mass of pbcl2?
278.1 g/molLead(II) chloride / Molar mass
What is the mass in grams of 6.57 10²⁵ molecules of N₂?
Therefore, the mass of 6. 57 * 10^25 molecules of N2 is 3052 grams.
What is the empirical formula for C6H6O6?
Benzenehexol | C6H6O6 – PubChem.
What is the molecular weight of C6H8O6?
C6H8O6 molecular weight. Molar mass of C6H8O6 = 176.12412 g/mol This compound is also known as Ascorbic Acid. Convert grams C6H8O6 to moles or moles C6H8O6 to grams Molecular weight calculation: 12.0107*6 + 1.00794*8 + 15.9994*6.
What is Br2 + C6H8O6?
• Br2 + C6H8O6 = 2HBr + C6H6O6 :: Chemistry Applications:: Chemical Elements, Periodic Table Compound Name Formula Search Moles to Grams Calculator Common Compounds List Chemical Equation Balancer Complete List of Acids Complete List of Bases Molar to Mass Concentration Converter Molar Mass Calculator Cations, Anions List Dilution Calculator
What is the equation for C6H8O6 + NaHCO3?
• C6H8O6 + NaHCO3 = NaC6H7O6 + H2O + CO2 • I2 + C6H8O6 = C6H6O6 + 2HI • C6H8O6 + NaOH = C6H7O6Na + H2O • C6H8O6 + KHCO3 = KC6H7O6 + H2O + CO2
What is the balanced equation for I2 + C6H8O6 + NaOH?
• I2 + C6H8O6 = C6H6O6 + 2HI • C6H8O6 + NaOH = C6H7O6Na + H2O • C6H8O6 + KHCO3 = KC6H7O6 + H2O + CO2
https://www.youtube.com/watch?v=aB5B3lp-GoY